C22H20Cl2FNO3 — CID 142105011
fluoro (2E)-6-cyano-2-[[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]methylidene]hexanoate (PubChem CID 142105011) has the molecular formula C22H20Cl2FNO3 and a molecular weight of 436.31 g/mol. Its IUPAC name is fluoro (2E)-6-cyano-2-[[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]methylidene]hexanoate.
| Compound Name | fluoro (2E)-6-cyano-2-[[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]methylidene]hexanoate |
|---|---|
| PubChem CID | 142105011 |
| Molecular Formula | C22H20Cl2FNO3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | fluoro (2E)-6-cyano-2-[[5-[(2,6-dichlorophenyl)methoxy]-2-methylphenyl]methylidene]hexanoate |
| SMILES | Cc1ccc(OCc2c(Cl)cccc2Cl)cc1/C=C(\CCCCC#N)C(=O)OF |
| InChI | InChI=1S/C22H20Cl2FNO3/c1-15-9-10-18(28-14-19-20(23)7-5-8-21(19)24)13-17(15)12-16(22(27)29-25)6-3-2-4-11-26/h5,7-10,12-13H,2-4,6,14H2,1H3/b16-12+ |
| InChIKey | YBCSTQUCLWJMNZ-FOWTUZBSSA-N |
| XLogP | 6.78 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|