C20H18Cl2N2O2 — CID 70162989
4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile (PubChem CID 70162989) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile.
| Compound Name | 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile |
|---|---|
| PubChem CID | 70162989 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile |
| SMILES | N#CCCCc1c(CO)[nH]c2ccc(OCc3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-17-5-3-6-18(22)16(17)12-26-13-7-8-19-15(10-13)14(4-1-2-9-23)20(11-25)24-19/h3,5-8,10,24-25H,1-2,4,11-12H2 |
| InChIKey | VOFTVNFWIKXMSE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|