About 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile
4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile (PubChem CID 70162989) has the molecular formula C20H18Cl2N2O2
and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile |
| PubChem CID | 70162989 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile |
| SMILES | N#CCCCc1c(CO)[nH]c2ccc(OCc3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-17-5-3-6-18(22)16(17)12-26-13-7-8-19-15(10-13)14(4-1-2-9-23)20(11-25)24-19/h3,5-8,10,24-25H,1-2,4,11-12H2 |
| InChIKey | VOFTVNFWIKXMSE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile?
The IUPAC name of 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile (CID 70162989) is 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile.
What is the SMILES notation for 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile?
The canonical SMILES for 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile is N#CCCCc1c(CO)[nH]c2ccc(OCc3c(Cl)cccc3Cl)cc12.
What is the InChIKey of 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile?
The InChIKey is VOFTVNFWIKXMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O2/c21-17-5-3-6-18(22)16(17)12-26-13-7-8-19-15(10-13)14(4-1-2-9-23)20(11-25)24-19/h3,5-8,10,24-25H,1-2,4,11-12H2.
What are the key properties of 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile?
4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile has a molecular weight of 389.28 g/mol, XLogP of 5.39, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(2,6-dichlorophenyl)methoxy]-2-(hydroxymethyl)-1H-indol-3-yl]butanenitrile is sourced from PubChem (CID 70162989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).