C24H32N2O4Si — CID 140751815
2-trimethylsilylethyl N-[2-[2-(hydroxymethyl)-5-phenylmethoxy-1H-indol-3-yl]ethyl]carbamate (PubChem CID 140751815) has the molecular formula C24H32N2O4Si and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[2-[2-(hydroxymethyl)-5-phenylmethoxy-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[2-[2-(hydroxymethyl)-5-phenylmethoxy-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140751815 |
| Molecular Formula | C24H32N2O4Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-trimethylsilylethyl N-[2-[2-(hydroxymethyl)-5-phenylmethoxy-1H-indol-3-yl]ethyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NCCc1c(CO)[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H32N2O4Si/c1-31(2,3)14-13-29-24(28)25-12-11-20-21-15-19(9-10-22(21)26-23(20)16-27)30-17-18-7-5-4-6-8-18/h4-10,15,26-27H,11-14,16-17H2,1-3H3,(H,25,28) |
| InChIKey | IAWYABLCNNLVSF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|