C23H34N4O4Si — CID 140751816
2-trimethylsilylethyl N-[2-[2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]carbamate (PubChem CID 140751816) has the molecular formula C23H34N4O4Si and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[2-[2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[2-[2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140751816 |
| Molecular Formula | C23H34N4O4Si |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-trimethylsilylethyl N-[2-[2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]carbamate |
| SMILES | Cc1[nH]c2ccc(OCCOc3ccn(C)n3)cc2c1CCNC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C23H34N4O4Si/c1-17-19(8-10-24-23(28)31-14-15-32(3,4)5)20-16-18(6-7-21(20)25-17)29-12-13-30-22-9-11-27(2)26-22/h6-7,9,11,16,25H,8,10,12-15H2,1-5H3,(H,24,28) |
| InChIKey | XNUXHAWIITYARI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|