C19H24FN5O3 — CID 122697972
1-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]-3-methylurea (PubChem CID 122697972) has the molecular formula C19H24FN5O3 and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]-3-methylurea.
| Compound Name | 1-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 122697972 |
| Molecular Formula | C19H24FN5O3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCc1c(C)[nH]c2cc(F)c(OCCOc3ccn(C)n3)cc12 |
| InChI | InChI=1S/C19H24FN5O3/c1-12-13(4-6-22-19(26)21-2)14-10-17(15(20)11-16(14)23-12)27-8-9-28-18-5-7-25(3)24-18/h5,7,10-11,23H,4,6,8-9H2,1-3H3,(H2,21,22,26) |
| InChIKey | XQERPRKCGMWHCR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|