C19H20F3N3O3 — CID 160511925
1,1-difluoro-5-[6-fluoro-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]pentan-2-one (PubChem CID 160511925) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 1,1-difluoro-5-[6-fluoro-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]pentan-2-one.
| Compound Name | 1,1-difluoro-5-[6-fluoro-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]pentan-2-one |
|---|---|
| PubChem CID | 160511925 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1,1-difluoro-5-[6-fluoro-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]pentan-2-one |
| SMILES | Cn1ccc(OCCOc2cc3c(CCCC(=O)C(F)F)c[nH]c3cc2F)n1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-25-6-5-18(24-25)28-8-7-27-17-9-13-12(3-2-4-16(26)19(21)22)11-23-15(13)10-14(17)20/h5-6,9-11,19,23H,2-4,7-8H2,1H3 |
| InChIKey | QTDSYGFPHSRCCQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|