C12H12ClF2N — CID 19438843
3-(4-chlorobutyl)-5,6-difluoro-1H-indole (PubChem CID 19438843) has the molecular formula C12H12ClF2N and a molecular weight of 243.68 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-5,6-difluoro-1H-indole.
| Compound Name | 3-(4-chlorobutyl)-5,6-difluoro-1H-indole |
|---|---|
| PubChem CID | 19438843 |
| Molecular Formula | C12H12ClF2N |
| Molecular Weight | 243.68 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(4-chlorobutyl)-5,6-difluoro-1H-indole |
| SMILES | Fc1cc2[nH]cc(CCCCCl)c2cc1F |
| InChI | InChI=1S/C12H12ClF2N/c13-4-2-1-3-8-7-16-12-6-11(15)10(14)5-9(8)12/h5-7,16H,1-4H2 |
| InChIKey | OIOXCPTYEYEJHJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|