C15H20F2N2 — CID 166670459
1-(5,6-difluoro-1H-indol-3-yl)-N-methylhexan-2-amine (PubChem CID 166670459) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-(5,6-difluoro-1H-indol-3-yl)-N-methylhexan-2-amine.
| Compound Name | 1-(5,6-difluoro-1H-indol-3-yl)-N-methylhexan-2-amine |
|---|---|
| PubChem CID | 166670459 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(5,6-difluoro-1H-indol-3-yl)-N-methylhexan-2-amine |
| SMILES | CCCCC(Cc1c[nH]c2cc(F)c(F)cc12)NC |
| InChI | InChI=1S/C15H20F2N2/c1-3-4-5-11(18-2)6-10-9-19-15-8-14(17)13(16)7-12(10)15/h7-9,11,18-19H,3-6H2,1-2H3 |
| InChIKey | YOWILHQYCSWOBL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |