C10H8F3N — CID 89153643
5,6-difluoro-3-(2-fluoroethyl)-1H-indole (PubChem CID 89153643) has the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. Its IUPAC name is 5,6-difluoro-3-(2-fluoroethyl)-1H-indole.
| Compound Name | 5,6-difluoro-3-(2-fluoroethyl)-1H-indole |
|---|---|
| PubChem CID | 89153643 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 5,6-difluoro-3-(2-fluoroethyl)-1H-indole |
| SMILES | FCCc1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C10H8F3N/c11-2-1-6-5-14-10-4-9(13)8(12)3-7(6)10/h3-5,14H,1-2H2 |
| InChIKey | VTIVYXPMIVTMGB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |