C16H22F2N2OS — CID 164554051
N-(5,6-difluoro-1H-indol-3-yl)octane-1-sulfinamide (PubChem CID 164554051) has the molecular formula C16H22F2N2OS and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(5,6-difluoro-1H-indol-3-yl)octane-1-sulfinamide.
| Compound Name | N-(5,6-difluoro-1H-indol-3-yl)octane-1-sulfinamide |
|---|---|
| PubChem CID | 164554051 |
| Molecular Formula | C16H22F2N2OS |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(5,6-difluoro-1H-indol-3-yl)octane-1-sulfinamide |
| SMILES | CCCCCCCCS(=O)Nc1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C16H22F2N2OS/c1-2-3-4-5-6-7-8-22(21)20-16-11-19-15-10-14(18)13(17)9-12(15)16/h9-11,19-20H,2-8H2,1H3 |
| InChIKey | NNPSJASVQDFYRZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|