C15H11ClF2N2OS — CID 154653155
1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide (PubChem CID 154653155) has the molecular formula C15H11ClF2N2OS and a molecular weight of 340.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide.
| Compound Name | 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide |
|---|---|
| PubChem CID | 154653155 |
| Molecular Formula | C15H11ClF2N2OS |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide |
| SMILES | O=S(Cc1cccc(Cl)c1)Nc1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C15H11ClF2N2OS/c16-10-3-1-2-9(4-10)8-22(21)20-15-7-19-14-6-13(18)12(17)5-11(14)15/h1-7,19-20H,8H2 |
| InChIKey | WJYISULAKBIRQG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |