About 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide
1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide (PubChem CID 154653155) has the molecular formula C15H11ClF2N2OS
and a molecular weight of 340.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide |
| PubChem CID | 154653155 |
| Molecular Formula | C15H11ClF2N2OS |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide |
| SMILES | O=S(Cc1cccc(Cl)c1)Nc1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C15H11ClF2N2OS/c16-10-3-1-2-9(4-10)8-22(21)20-15-7-19-14-6-13(18)12(17)5-11(14)15/h1-7,19-20H,8H2 |
| InChIKey | WJYISULAKBIRQG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide?
The IUPAC name of 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide (CID 154653155) is 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide.
What is the SMILES notation for 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide?
The canonical SMILES for 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide is O=S(Cc1cccc(Cl)c1)Nc1c[nH]c2cc(F)c(F)cc12.
What is the InChIKey of 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide?
The InChIKey is WJYISULAKBIRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF2N2OS/c16-10-3-1-2-9(4-10)8-22(21)20-15-7-19-14-6-13(18)12(17)5-11(14)15/h1-7,19-20H,8H2.
What are the key properties of 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide?
1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide has a molecular weight of 340.78 g/mol, XLogP of 4.38, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-N-(5,6-difluoro-1H-indol-3-yl)methanesulfinamide is sourced from PubChem (CID 154653155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).