C18H11F2N3OS — CID 162444829
N-(5,6-difluoro-1H-indol-3-yl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 162444829) has the molecular formula C18H11F2N3OS and a molecular weight of 355.37 g/mol. Its IUPAC name is N-(5,6-difluoro-1H-indol-3-yl)-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5,6-difluoro-1H-indol-3-yl)-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162444829 |
| Molecular Formula | C18H11F2N3OS |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-(5,6-difluoro-1H-indol-3-yl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1c[nH]c2cc(F)c(F)cc12)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H11F2N3OS/c19-12-6-11-14(7-13(12)20)21-8-15(11)22-17(24)16-9-25-18(23-16)10-4-2-1-3-5-10/h1-9,21H,(H,22,24) |
| InChIKey | WRGXWXQFWPGOFF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |