C8H4ClF2NOS — CID 135201076
5,6-difluoro-1H-indole-3-sulfinyl chloride (PubChem CID 135201076) has the molecular formula C8H4ClF2NOS and a molecular weight of 235.64 g/mol. Its IUPAC name is 5,6-difluoro-1H-indole-3-sulfinyl chloride.
| Compound Name | 5,6-difluoro-1H-indole-3-sulfinyl chloride |
|---|---|
| PubChem CID | 135201076 |
| Molecular Formula | C8H4ClF2NOS |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 5,6-difluoro-1H-indole-3-sulfinyl chloride |
| SMILES | O=S(Cl)c1c[nH]c2cc(F)c(F)cc12 |
| InChI | InChI=1S/C8H4ClF2NOS/c9-14(13)8-3-12-7-2-6(11)5(10)1-4(7)8/h1-3,12H |
| InChIKey | PAOGHZUEYWQEME-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |