C16H11F5N2S — CID 154653148
5,6-difluoro-N-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1H-indol-3-amine (PubChem CID 154653148) has the molecular formula C16H11F5N2S and a molecular weight of 358.34 g/mol. Its IUPAC name is 5,6-difluoro-N-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1H-indol-3-amine.
| Compound Name | 5,6-difluoro-N-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1H-indol-3-amine |
|---|---|
| PubChem CID | 154653148 |
| Molecular Formula | C16H11F5N2S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 5,6-difluoro-N-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1H-indol-3-amine |
| SMILES | Fc1cc2[nH]cc(NSCc3cccc(C(F)(F)F)c3)c2cc1F |
| InChI | InChI=1S/C16H11F5N2S/c17-12-5-11-14(6-13(12)18)22-7-15(11)23-24-8-9-2-1-3-10(4-9)16(19,20)21/h1-7,22-23H,8H2 |
| InChIKey | LBKRTBCQPDTVJY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|