C28H16F5N3O2 — CID 19429586
3,4-bis(6-fluoro-1H-indol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione (PubChem CID 19429586) has the molecular formula C28H16F5N3O2 and a molecular weight of 521.45 g/mol. Its IUPAC name is 3,4-bis(6-fluoro-1H-indol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione.
| Compound Name | 3,4-bis(6-fluoro-1H-indol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19429586 |
| Molecular Formula | C28H16F5N3O2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 3,4-bis(6-fluoro-1H-indol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2c[nH]c3cc(F)ccc23)=C(c2c[nH]c3cc(F)ccc23)C(=O)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H16F5N3O2/c29-16-4-6-18-20(11-34-22(18)9-16)24-25(21-12-35-23-10-17(30)5-7-19(21)23)27(38)36(26(24)37)13-14-2-1-3-15(8-14)28(31,32)33/h1-12,34-35H,13H2 |
| InChIKey | OQFZLRARJIJBGW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|