C28H14F5N3O2 — CID 23208107
6,20-difluoro-13-[[3-(trifluoromethyl)phenyl]methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 23208107) has the molecular formula C28H14F5N3O2 and a molecular weight of 519.43 g/mol. Its IUPAC name is 6,20-difluoro-13-[[3-(trifluoromethyl)phenyl]methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 6,20-difluoro-13-[[3-(trifluoromethyl)phenyl]methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 23208107 |
| Molecular Formula | C28H14F5N3O2 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 6,20-difluoro-13-[[3-(trifluoromethyl)phenyl]methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | O=C1c2c(c3c4ccc(F)cc4[nH]c3c3[nH]c4cc(F)ccc4c23)C(=O)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H14F5N3O2/c29-14-4-6-16-18(9-14)34-24-20(16)22-23(21-17-7-5-15(30)10-19(17)35-25(21)24)27(38)36(26(22)37)11-12-2-1-3-13(8-12)28(31,32)33/h1-10,34-35H,11H2 |
| InChIKey | KYJOGXSCYCKYQU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|