C20H16F3NO5 — CID 110581418
3-(3,4-dimethoxyphenyl)-4-hydroxy-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione (PubChem CID 110581418) has the molecular formula C20H16F3NO5 and a molecular weight of 407.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-hydroxy-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-hydroxy-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581418 |
| Molecular Formula | C20H16F3NO5 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-hydroxy-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(O)C(=O)N(Cc3cccc(C(F)(F)F)c3)C2=O)cc1OC |
| InChI | InChI=1S/C20H16F3NO5/c1-28-14-7-6-12(9-15(14)29-2)16-17(25)19(27)24(18(16)26)10-11-4-3-5-13(8-11)20(21,22)23/h3-9,25H,10H2,1-2H3 |
| InChIKey | BQRXKEVJPDQBFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|