C24H27NO7 — CID 110581438
1-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110581438) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581438 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | CCOc1ccc(CCN2C(=O)C(O)=C(c3ccc(OC)c(OC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C24H27NO7/c1-5-31-18-9-7-15(13-20(18)32-6-2)11-12-25-23(27)21(22(26)24(25)28)16-8-10-17(29-3)19(14-16)30-4/h7-10,13-14,26H,5-6,11-12H2,1-4H3 |
| InChIKey | FSJDGIBPTJZDOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|