C23H25NO6 — CID 110581569
1-[2-(3,4-diethoxyphenyl)ethyl]-3-hydroxy-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110581569) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-hydroxy-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-hydroxy-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581569 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-hydroxy-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(CCN2C(=O)C(O)=C(c3ccccc3OC)C2=O)cc1OCC |
| InChI | InChI=1S/C23H25NO6/c1-4-29-18-11-10-15(14-19(18)30-5-2)12-13-24-22(26)20(21(25)23(24)27)16-8-6-7-9-17(16)28-3/h6-11,14,25H,4-5,12-13H2,1-3H3 |
| InChIKey | RVENTLVMIHZNIO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|