C19H14F5N3O2 — CID 167322945
N-(5,6-difluoro-1H-indol-3-yl)-N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]oxamide (PubChem CID 167322945) has the molecular formula C19H14F5N3O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is N-(5,6-difluoro-1H-indol-3-yl)-N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]oxamide.
| Compound Name | N-(5,6-difluoro-1H-indol-3-yl)-N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 167322945 |
| Molecular Formula | C19H14F5N3O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-(5,6-difluoro-1H-indol-3-yl)-N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)Nc1c[nH]c2cc(F)c(F)cc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F5N3O2/c1-9(10-2-4-11(5-3-10)19(22,23)24)26-17(28)18(29)27-16-8-25-15-7-14(21)13(20)6-12(15)16/h2-9,25H,1H3,(H,26,28)(H,27,29)/t9-/m0/s1 |
| InChIKey | IHRCRQHMLIBTCW-VIFPVBQESA-N |
| XLogP | 4.28 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|