C14H13F2N3O2 — CID 156720645
N-cyclobutyl-N'-(5,6-difluoro-1H-indol-3-yl)oxamide (PubChem CID 156720645) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is N-cyclobutyl-N'-(5,6-difluoro-1H-indol-3-yl)oxamide.
| Compound Name | N-cyclobutyl-N'-(5,6-difluoro-1H-indol-3-yl)oxamide |
|---|---|
| PubChem CID | 156720645 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-cyclobutyl-N'-(5,6-difluoro-1H-indol-3-yl)oxamide |
| SMILES | O=C(Nc1c[nH]c2cc(F)c(F)cc12)C(=O)NC1CCC1 |
| InChI | InChI=1S/C14H13F2N3O2/c15-9-4-8-11(5-10(9)16)17-6-12(8)19-14(21)13(20)18-7-2-1-3-7/h4-7,17H,1-3H2,(H,18,20)(H,19,21) |
| InChIKey | OZPAQSODBMZNFX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|