C21H20F2N2O2 — CID 162444906
4-cyclohexyloxy-N-(5,6-difluoro-1H-indol-3-yl)benzamide (PubChem CID 162444906) has the molecular formula C21H20F2N2O2 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-(5,6-difluoro-1H-indol-3-yl)benzamide.
| Compound Name | 4-cyclohexyloxy-N-(5,6-difluoro-1H-indol-3-yl)benzamide |
|---|---|
| PubChem CID | 162444906 |
| Molecular Formula | C21H20F2N2O2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-cyclohexyloxy-N-(5,6-difluoro-1H-indol-3-yl)benzamide |
| SMILES | O=C(Nc1c[nH]c2cc(F)c(F)cc12)c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H20F2N2O2/c22-17-10-16-19(11-18(17)23)24-12-20(16)25-21(26)13-6-8-15(9-7-13)27-14-4-2-1-3-5-14/h6-12,14,24H,1-5H2,(H,25,26) |
| InChIKey | WRHLLZNGKWKBMX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |