C42H56N4O8 — CID 54305903
tert-butyl N-[3-[2-[2-[3-[[3-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxy-1H-indole-2-carbonyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate (PubChem CID 54305903) has the molecular formula C42H56N4O8 and a molecular weight of 744.93 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[3-[[3-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxy-1H-indole-2-carbonyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[3-[[3-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxy-1H-indole-2-carbonyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate |
|---|---|
| PubChem CID | 54305903 |
| Molecular Formula | C42H56N4O8 |
| Molecular Weight | 744.93 g/mol |
| Exact Mass | 744.41 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[3-[[3-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxy-1H-indole-2-carbonyl]amino]propoxy]ethoxy]ethoxy]propyl]carbamate |
| SMILES | CN(CCc1ccccc1)C(=O)Cc1c(C(=O)NCCCOCCOCCOCCCNC(=O)OC(C)(C)C)[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C42H56N4O8/c1-42(2,3)54-41(49)44-21-12-24-51-26-28-52-27-25-50-23-11-20-43-40(48)39-36(30-38(47)46(4)22-19-32-13-7-5-8-14-32)35-29-34(17-18-37(35)45-39)53-31-33-15-9-6-10-16-33/h5-10,13-18,29,45H,11-12,19-28,30-31H2,1-4H3,(H,43,48)(H,44,49) |
| InChIKey | SHLYKKAKCAOTOH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|