C25H21NO5 — CID 174324052
3-[2-(1,3-benzodioxol-5-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxylic acid (PubChem CID 174324052) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 174324052 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-5-phenylmethoxy-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ccc(OCc3ccccc3)cc2c1CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H21NO5/c27-25(28)24-19(9-6-16-7-11-22-23(12-16)31-15-30-22)20-13-18(8-10-21(20)26-24)29-14-17-4-2-1-3-5-17/h1-5,7-8,10-13,26H,6,9,14-15H2,(H,27,28) |
| InChIKey | OEXOEZILCMABJJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|