C25H18ClNO7 — CID 70101051
5-[(4-carboxyphenyl)methoxy]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1H-indole-2-carboxylic acid (PubChem CID 70101051) has the molecular formula C25H18ClNO7 and a molecular weight of 479.87 g/mol. Its IUPAC name is 5-[(4-carboxyphenyl)methoxy]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[(4-carboxyphenyl)methoxy]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 70101051 |
| Molecular Formula | C25H18ClNO7 |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 5-[(4-carboxyphenyl)methoxy]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2ccc3[nH]c(C(=O)O)c(Cc4cc5c(cc4Cl)OCO5)c3c2)cc1 |
| InChI | InChI=1S/C25H18ClNO7/c26-19-10-22-21(33-12-34-22)8-15(19)7-18-17-9-16(5-6-20(17)27-23(18)25(30)31)32-11-13-1-3-14(4-2-13)24(28)29/h1-6,8-10,27H,7,11-12H2,(H,28,29)(H,30,31) |
| InChIKey | CKYIKTREHSLSTK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|