C27H21ClN2O5 — CID 70099059
ethyl 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(4-cyanophenyl)methoxy]-1H-indole-2-carboxylate (PubChem CID 70099059) has the molecular formula C27H21ClN2O5 and a molecular weight of 488.93 g/mol. Its IUPAC name is ethyl 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(4-cyanophenyl)methoxy]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(4-cyanophenyl)methoxy]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 70099059 |
| Molecular Formula | C27H21ClN2O5 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | ethyl 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(4-cyanophenyl)methoxy]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OCc3ccc(C#N)cc3)cc2c1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C27H21ClN2O5/c1-2-32-27(31)26-21(9-18-10-24-25(12-22(18)28)35-15-34-24)20-11-19(7-8-23(20)30-26)33-14-17-5-3-16(13-29)4-6-17/h3-8,10-12,30H,2,9,14-15H2,1H3 |
| InChIKey | KCFGPVTUNVCQKD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|