C29H25N3O9 — CID 15140322
5-[2-[(2-carboxybenzoyl)amino]ethoxy]-3-[2-[(2-carboxybenzoyl)amino]ethyl]-1H-indole-2-carboxylic acid (PubChem CID 15140322) has the molecular formula C29H25N3O9 and a molecular weight of 559.53 g/mol. Its IUPAC name is 5-[2-[(2-carboxybenzoyl)amino]ethoxy]-3-[2-[(2-carboxybenzoyl)amino]ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[2-[(2-carboxybenzoyl)amino]ethoxy]-3-[2-[(2-carboxybenzoyl)amino]ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 15140322 |
| Molecular Formula | C29H25N3O9 |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 5-[2-[(2-carboxybenzoyl)amino]ethoxy]-3-[2-[(2-carboxybenzoyl)amino]ethyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCCOc1ccc2[nH]c(C(=O)O)c(CCNC(=O)c3ccccc3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H25N3O9/c33-25(18-5-1-3-7-20(18)27(35)36)30-12-11-17-22-15-16(9-10-23(22)32-24(17)29(39)40)41-14-13-31-26(34)19-6-2-4-8-21(19)28(37)38/h1-10,15,32H,11-14H2,(H,30,33)(H,31,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | QGBCNBHXNFRDOH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 195.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|