C17H14BrFN2O2 — CID 55818324
3-bromo-N-[2-(3-fluorophenoxy)ethyl]-1H-indole-2-carboxamide (PubChem CID 55818324) has the molecular formula C17H14BrFN2O2 and a molecular weight of 377.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(3-fluorophenoxy)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(3-fluorophenoxy)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55818324 |
| Molecular Formula | C17H14BrFN2O2 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-bromo-N-[2-(3-fluorophenoxy)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCOc1cccc(F)c1)c1[nH]c2ccccc2c1Br |
| InChI | InChI=1S/C17H14BrFN2O2/c18-15-13-6-1-2-7-14(13)21-16(15)17(22)20-8-9-23-12-5-3-4-11(19)10-12/h1-7,10,21H,8-9H2,(H,20,22) |
| InChIKey | RKPYTDXURPYESN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|