C14H13BrFN3O3S — CID 78892353
1-[(5-bromothiophene-2-carbonyl)amino]-3-[2-(3-fluorophenoxy)ethyl]urea (PubChem CID 78892353) has the molecular formula C14H13BrFN3O3S and a molecular weight of 402.25 g/mol. Its IUPAC name is 1-[(5-bromothiophene-2-carbonyl)amino]-3-[2-(3-fluorophenoxy)ethyl]urea.
| Compound Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-[2-(3-fluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 78892353 |
| Molecular Formula | C14H13BrFN3O3S |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-[2-(3-fluorophenoxy)ethyl]urea |
| SMILES | O=C(NCCOc1cccc(F)c1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H13BrFN3O3S/c15-12-5-4-11(23-12)13(20)18-19-14(21)17-6-7-22-10-3-1-2-9(16)8-10/h1-5,8H,6-7H2,(H,18,20)(H2,17,19,21) |
| InChIKey | BXUMREKOZBKGRU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|