C19H17FN2O3 — CID 51098622
N-[3-(4-fluorophenoxy)propyl]-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 51098622) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 51098622 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | O=C(NCCCOc1ccc(F)cc1)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C19H17FN2O3/c20-13-6-8-14(9-7-13)25-11-3-10-21-19(24)17-12-18(23)15-4-1-2-5-16(15)22-17/h1-2,4-9,12H,3,10-11H2,(H,21,24)(H,22,23) |
| InChIKey | KZVXZGAUVZBRLT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|