C24H25Cl2N3O2 — CID 70029571
1-(3-cyanopropyl)-5-[(2,6-dichlorophenyl)methoxy]-N,N-diethylindole-2-carboxamide (PubChem CID 70029571) has the molecular formula C24H25Cl2N3O2 and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-(3-cyanopropyl)-5-[(2,6-dichlorophenyl)methoxy]-N,N-diethylindole-2-carboxamide.
| Compound Name | 1-(3-cyanopropyl)-5-[(2,6-dichlorophenyl)methoxy]-N,N-diethylindole-2-carboxamide |
|---|---|
| PubChem CID | 70029571 |
| Molecular Formula | C24H25Cl2N3O2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 1-(3-cyanopropyl)-5-[(2,6-dichlorophenyl)methoxy]-N,N-diethylindole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2cc(OCc3c(Cl)cccc3Cl)ccc2n1CCCC#N |
| InChI | InChI=1S/C24H25Cl2N3O2/c1-3-28(4-2)24(30)23-15-17-14-18(10-11-22(17)29(23)13-6-5-12-27)31-16-19-20(25)8-7-9-21(19)26/h7-11,14-15H,3-6,13,16H2,1-2H3 |
| InChIKey | OHZYRLCDFULBRY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|