C16H22BrN3O — CID 169006404
5-bromo-1-butyl-N,N-diethylpyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 169006404) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-bromo-1-butyl-N,N-diethylpyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-bromo-1-butyl-N,N-diethylpyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169006404 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-bromo-1-butyl-N,N-diethylpyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCCCn1c(C(=O)N(CC)CC)cc2cc(Br)ncc21 |
| InChI | InChI=1S/C16H22BrN3O/c1-4-7-8-20-13(16(21)19(5-2)6-3)9-12-10-15(17)18-11-14(12)20/h9-11H,4-8H2,1-3H3 |
| InChIKey | SZUAJYAESPIEQW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|