C9H14N3O9P — CID 154068815
[(2R,3S,4R)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 154068815) has the molecular formula C9H14N3O9P and a molecular weight of 339.20 g/mol. Its IUPAC name is [(2R,3S,4R)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 154068815 |
| Molecular Formula | C9H14N3O9P |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [(2R,3S,4R)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1cc(NC2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N3O9P/c13-5-1-4(11-9(16)12-5)10-8-7(15)6(14)3(21-8)2-20-22(17,18)19/h1,3,6-8,14-15H,2H2,(H2,17,18,19)(H3,10,11,12,13,16)/t3-,6-,7-,8?/m1/s1 |
| InChIKey | LILTWPDESZGOLD-JQJYPAMWSA-N |
| XLogP | -2.97 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|