About [methyl(propyl)silyl] acetate
[methyl(propyl)silyl] acetate (PubChem CID 154069177) has the molecular formula C6H14O2Si
and a molecular weight of 146.26 g/mol. Its IUPAC name is [methyl(propyl)silyl] acetate.
Molecular Properties
| Compound Name | [methyl(propyl)silyl] acetate |
| PubChem CID | 154069177 |
| Molecular Formula | C6H14O2Si |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | [methyl(propyl)silyl] acetate |
| SMILES | CCC[SiH](C)OC(C)=O |
| InChI | InChI=1S/C6H14O2Si/c1-4-5-9(3)8-6(2)7/h9H,4-5H2,1-3H3 |
| InChIKey | ODNKJAPPIIGYEH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [methyl(propyl)silyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(propyl)silyl] acetate?
The IUPAC name of [methyl(propyl)silyl] acetate (CID 154069177) is [methyl(propyl)silyl] acetate.
What is the SMILES notation for [methyl(propyl)silyl] acetate?
The canonical SMILES for [methyl(propyl)silyl] acetate is CCC[SiH](C)OC(C)=O.
What is the InChIKey of [methyl(propyl)silyl] acetate?
The InChIKey is ODNKJAPPIIGYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2Si/c1-4-5-9(3)8-6(2)7/h9H,4-5H2,1-3H3.
What are the key properties of [methyl(propyl)silyl] acetate?
[methyl(propyl)silyl] acetate has a molecular weight of 146.26 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(propyl)silyl] acetate is sourced from PubChem (CID 154069177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).