C11H11FN2O4 — CID 154069598
6-fluoro-8-(2-methoxyethoxy)imidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 154069598) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is 6-fluoro-8-(2-methoxyethoxy)imidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 6-fluoro-8-(2-methoxyethoxy)imidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 154069598 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6-fluoro-8-(2-methoxyethoxy)imidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | COCCOc1cc(F)cn2cc(C(=O)O)nc12 |
| InChI | InChI=1S/C11H11FN2O4/c1-17-2-3-18-9-4-7(12)5-14-6-8(11(15)16)13-10(9)14/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | OTWJWNZCTJFDJZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|