C9H10FNaO4S — CID 165454527
sodium 5-fluoro-2-(2-methoxyethoxy)benzenesulfinate (PubChem CID 165454527) has the molecular formula C9H10FNaO4S and a molecular weight of 256.23 g/mol. Its IUPAC name is sodium 5-fluoro-2-(2-methoxyethoxy)benzenesulfinate.
| Compound Name | sodium 5-fluoro-2-(2-methoxyethoxy)benzenesulfinate |
|---|---|
| PubChem CID | 165454527 |
| Molecular Formula | C9H10FNaO4S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | sodium 5-fluoro-2-(2-methoxyethoxy)benzenesulfinate |
| SMILES | COCCOc1ccc(F)cc1S(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H11FO4S.Na/c1-13-4-5-14-8-3-2-7(10)6-9(8)15(11)12;/h2-3,6H,4-5H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | ZYRUNQGOQOHZSJ-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|