C6H5F6O4P-2 — CID 154069604
4,4,4-trifluoro-1-phosphonato-2-(2,2,2-trifluoroethyl)butan-1-one (PubChem CID 154069604) has the molecular formula C6H5F6O4P-2 and a molecular weight of 286.06 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-phosphonato-2-(2,2,2-trifluoroethyl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-phosphonato-2-(2,2,2-trifluoroethyl)butan-1-one |
|---|---|
| PubChem CID | 154069604 |
| Molecular Formula | C6H5F6O4P-2 |
| Molecular Weight | 286.06 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4,4,4-trifluoro-1-phosphonato-2-(2,2,2-trifluoroethyl)butan-1-one |
| SMILES | O=C(C(CC(F)(F)F)CC(F)(F)F)P(=O)([O-])[O-] |
| InChI | InChI=1S/C6H7F6O4P/c7-5(8,9)1-3(2-6(10,11)12)4(13)17(14,15)16/h3H,1-2H2,(H2,14,15,16)/p-2 |
| InChIKey | TZOYYWKEHVLXGM-UHFFFAOYSA-L |
| XLogP | 0.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|