C18H36F3NO2SSn — CID 154070744
1,1,1-trifluoro-N-(3-tributylstannylpent-3-enyl)methanesulfonamide (PubChem CID 154070744) has the molecular formula C18H36F3NO2SSn and a molecular weight of 506.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(3-tributylstannylpent-3-enyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(3-tributylstannylpent-3-enyl)methanesulfonamide |
|---|---|
| PubChem CID | 154070744 |
| Molecular Formula | C18H36F3NO2SSn |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1,1,1-trifluoro-N-(3-tributylstannylpent-3-enyl)methanesulfonamide |
| SMILES | CC=C(CCNS(=O)(=O)C(F)(F)F)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C6H9F3NO2S.3C4H9.Sn/c1-2-3-4-5-10-13(11,12)6(7,8)9;3*1-3-4-2;/h2,10H,4-5H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YBFPTMNGQFERNH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |