C10H16F3NO2S — CID 163881456
1,1,1-trifluoro-N-[(Z)-2-methyl-2-[(Z)-prop-1-enyl]pent-3-enyl]methanesulfonamide (PubChem CID 163881456) has the molecular formula C10H16F3NO2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(Z)-2-methyl-2-[(Z)-prop-1-enyl]pent-3-enyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(Z)-2-methyl-2-[(Z)-prop-1-enyl]pent-3-enyl]methanesulfonamide |
|---|---|
| PubChem CID | 163881456 |
| Molecular Formula | C10H16F3NO2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[(Z)-2-methyl-2-[(Z)-prop-1-enyl]pent-3-enyl]methanesulfonamide |
| SMILES | C/C=C\C(C)(/C=C\C)CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2S/c1-4-6-9(3,7-5-2)8-14-17(15,16)10(11,12)13/h4-7,14H,8H2,1-3H3/b6-4-,7-5- |
| InChIKey | PTOCTQNAQSRWMG-PEPZGXQESA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|