C17H21ClN4O2 — CID 154071084
[1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl N-cyclohexylcarbamate (PubChem CID 154071084) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl N-cyclohexylcarbamate.
| Compound Name | [1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 154071084 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]triazol-4-yl]methyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCc1cn(Cc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-14-8-6-13(7-9-14)10-22-11-16(20-21-22)12-24-17(23)19-15-4-2-1-3-5-15/h6-9,11,15H,1-5,10,12H2,(H,19,23) |
| InChIKey | JYRLAJORCVTJGT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |