C14H14F3N3O2 — CID 154071973
2-methyl-N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]benzamide (PubChem CID 154071973) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-methyl-N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]benzamide.
| Compound Name | 2-methyl-N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 154071973 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-methyl-N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCc1c(C(F)(F)F)[nH]n(C)c1=O |
| InChI | InChI=1S/C14H14F3N3O2/c1-8-5-3-4-6-9(8)12(21)18-7-10-11(14(15,16)17)19-20(2)13(10)22/h3-6,19H,7H2,1-2H3,(H,18,21) |
| InChIKey | OKMOXSYTRGLDRV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |