C16H11Cl3N2O — CID 154076703
2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride (PubChem CID 154076703) has the molecular formula C16H11Cl3N2O and a molecular weight of 353.64 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride.
| Compound Name | 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 154076703 |
| Molecular Formula | C16H11Cl3N2O |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CC(c2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3N2O/c17-12-5-1-10(2-6-12)14-9-21(16(19)22)15(20-14)11-3-7-13(18)8-4-11/h1-8,14H,9H2 |
| InChIKey | OIFFGCBUGRKHEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|