About 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride
2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride (PubChem CID 154076703) has the molecular formula C16H11Cl3N2O
and a molecular weight of 353.64 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride.
Molecular Properties
| Compound Name | 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
| PubChem CID | 154076703 |
| Molecular Formula | C16H11Cl3N2O |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CC(c2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3N2O/c17-12-5-1-10(2-6-12)14-9-21(16(19)22)15(20-14)11-3-7-13(18)8-4-11/h1-8,14H,9H2 |
| InChIKey | OIFFGCBUGRKHEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride?
The IUPAC name of 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride (CID 154076703) is 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride.
What is the SMILES notation for 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride?
The canonical SMILES for 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride is O=C(Cl)N1CC(c2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1.
What is the InChIKey of 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride?
The InChIKey is OIFFGCBUGRKHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl3N2O/c17-12-5-1-10(2-6-12)14-9-21(16(19)22)15(20-14)11-3-7-13(18)8-4-11/h1-8,14H,9H2.
What are the key properties of 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride?
2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride has a molecular weight of 353.64 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride is sourced from PubChem (CID 154076703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).