C23H27N2O+ — CID 154079357
2-benzyl-7-ethoxy-9-ethyl-1-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium (PubChem CID 154079357) has the molecular formula C23H27N2O+ and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-benzyl-7-ethoxy-9-ethyl-1-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium.
| Compound Name | 2-benzyl-7-ethoxy-9-ethyl-1-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 154079357 |
| Molecular Formula | C23H27N2O+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-benzyl-7-ethoxy-9-ethyl-1-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium |
| SMILES | CCOc1ccc2c3c(n(CC)c2c1)C(C)=[N+](Cc1ccccc1)CC3 |
| InChI | InChI=1S/C23H27N2O/c1-4-25-22-15-19(26-5-2)11-12-20(22)21-13-14-24(17(3)23(21)25)16-18-9-7-6-8-10-18/h6-12,15H,4-5,13-14,16H2,1-3H3/q+1 |
| InChIKey | IDDMDYPXTZBCQC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|