C32H33F6N3O3 — CID 15408017
1-[4-[3,5-bis(trifluoromethyl)benzoyl]-5-phenyl-1,4-diazepan-1-yl]-4-[(2-methoxyphenyl)methylamino]butan-1-one (PubChem CID 15408017) has the molecular formula C32H33F6N3O3 and a molecular weight of 621.62 g/mol. Its IUPAC name is 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-5-phenyl-1,4-diazepan-1-yl]-4-[(2-methoxyphenyl)methylamino]butan-1-one.
| Compound Name | 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-5-phenyl-1,4-diazepan-1-yl]-4-[(2-methoxyphenyl)methylamino]butan-1-one |
|---|---|
| PubChem CID | 15408017 |
| Molecular Formula | C32H33F6N3O3 |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-5-phenyl-1,4-diazepan-1-yl]-4-[(2-methoxyphenyl)methylamino]butan-1-one |
| SMILES | COc1ccccc1CNCCCC(=O)N1CCC(c2ccccc2)N(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C32H33F6N3O3/c1-44-28-11-6-5-10-23(28)21-39-14-7-12-29(42)40-15-13-27(22-8-3-2-4-9-22)41(17-16-40)30(43)24-18-25(31(33,34)35)20-26(19-24)32(36,37)38/h2-6,8-11,18-20,27,39H,7,12-17,21H2,1H3 |
| InChIKey | WTDONARWEALOKF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|