About 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid
3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid (PubChem CID 154081908) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid |
| PubChem CID | 154081908 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(O)(c2ccns2)C1 |
| InChI | InChI=1S/C7H8N2O3S/c10-6(11)9-3-7(12,4-9)5-1-2-8-13-5/h1-2,12H,3-4H2,(H,10,11) |
| InChIKey | GYIAIHXGQUBNJF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid?
The IUPAC name of 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid (CID 154081908) is 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid.
What is the SMILES notation for 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid?
The canonical SMILES for 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid is O=C(O)N1CC(O)(c2ccns2)C1.
What is the InChIKey of 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid?
The InChIKey is GYIAIHXGQUBNJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c10-6(11)9-3-7(12,4-9)5-1-2-8-13-5/h1-2,12H,3-4H2,(H,10,11).
What are the key properties of 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid?
3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid has a molecular weight of 200.22 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-(1,2-thiazol-5-yl)azetidine-1-carboxylic acid is sourced from PubChem (CID 154081908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).