C10H16N2OS — CID 164764062
1-tert-butyl-3-(1,2-thiazol-5-yl)azetidin-3-ol (PubChem CID 164764062) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-tert-butyl-3-(1,2-thiazol-5-yl)azetidin-3-ol.
| Compound Name | 1-tert-butyl-3-(1,2-thiazol-5-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 164764062 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-tert-butyl-3-(1,2-thiazol-5-yl)azetidin-3-ol |
| SMILES | CC(C)(C)N1CC(O)(c2ccns2)C1 |
| InChI | InChI=1S/C10H16N2OS/c1-9(2,3)12-6-10(13,7-12)8-4-5-11-14-8/h4-5,13H,6-7H2,1-3H3 |
| InChIKey | ZIQJREHPPMPOMZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |