C21H32O4 — CID 154083455
(8S,9S,10S,13R,14S,17S)-17-acetyl-15,15-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 154083455) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,17S)-17-acetyl-15,15-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (8S,9S,10S,13R,14S,17S)-17-acetyl-15,15-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 154083455 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (8S,9S,10S,13R,14S,17S)-17-acetyl-15,15-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | CC(=O)[C@H]1CC(O)(O)[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C21H32O4/c1-12(22)15-10-21(24,25)18-14-8-7-13-6-4-5-9-19(13,2)17(14)16(23)11-20(15,18)3/h13-15,17-18,24-25H,4-11H2,1-3H3/t13?,14-,15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | KTJZDITZKUYYLX-CLWZGTPUSA-N |
| XLogP | 3.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|