C23H34O2 — CID 165129155
(17Z)-13-ethenyl-17-(1-methoxyethylidene)-10-methyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 165129155) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (17Z)-13-ethenyl-17-(1-methoxyethylidene)-10-methyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (17Z)-13-ethenyl-17-(1-methoxyethylidene)-10-methyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 165129155 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (17Z)-13-ethenyl-17-(1-methoxyethylidene)-10-methyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | C=CC12CC(=O)C3C(CCC4CCCCC43C)C1CC/C2=C(\C)OC |
| InChI | InChI=1S/C23H34O2/c1-5-23-14-20(24)21-17(19(23)12-11-18(23)15(2)25-4)10-9-16-8-6-7-13-22(16,21)3/h5,16-17,19,21H,1,6-14H2,2-4H3/b18-15- |
| InChIKey | VYIHBNRUPPSDKM-SDXDJHTJSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|