C23H33NO — CID 162152159
(3S,5R,8S,9S,10S,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 162152159) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (3S,5R,8S,9S,10S,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (3S,5R,8S,9S,10S,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 162152159 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (3S,5R,8S,9S,10S,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | [C-]#[N+]/C(C)=C1/CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](C)CC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C23H33NO/c1-14-10-11-22(3)16(12-14)6-7-17-19-9-8-18(15(2)24-5)23(19,4)13-20(25)21(17)22/h14,16-17,19,21H,6-13H2,1-4H3/b18-15-/t14-,16+,17-,19-,21+,22-,23+/m0/s1 |
| InChIKey | LQQGMPKLHLGISG-PLXJQCRMSA-N |
| XLogP | 6.04 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|