C23H31NO3 — CID 159212141
(2R,5R,8S,9S,10S,13S,14S,17Z)-2-(hydroxymethyl)-17-(1-isocyanoethylidene)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 159212141) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2R,5R,8S,9S,10S,13S,14S,17Z)-2-(hydroxymethyl)-17-(1-isocyanoethylidene)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (2R,5R,8S,9S,10S,13S,14S,17Z)-2-(hydroxymethyl)-17-(1-isocyanoethylidene)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 159212141 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2R,5R,8S,9S,10S,13S,14S,17Z)-2-(hydroxymethyl)-17-(1-isocyanoethylidene)-10,13-dimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | [C-]#[N+]/C(C)=C1/CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)[C@@H](CO)C[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C23H31NO3/c1-13(24-4)17-7-8-18-16-6-5-15-9-19(26)14(12-25)10-22(15,2)21(16)20(27)11-23(17,18)3/h14-16,18,21,25H,5-12H2,1-3H3/b17-13-/t14-,15-,16+,18+,21-,22+,23-/m1/s1 |
| InChIKey | DRCUECISDQGQST-DZKBUZEVSA-N |
| XLogP | 4.19 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|